C19H36FNO2S — CID 143418319
ethane;(Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine;methoxymethane (PubChem CID 143418319) has the molecular formula C19H36FNO2S and a molecular weight of 361.57 g/mol. Its IUPAC name is ethane;(Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine;methoxymethane.
| Compound Name | ethane;(Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine;methoxymethane |
|---|---|
| PubChem CID | 143418319 |
| Molecular Formula | C19H36FNO2S |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | ethane;(Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine;methoxymethane |
| SMILES | C/C=C(\C=C/C(C)C1=CCS(=O)CC1)CC(N)CF.CC.COC |
| InChI | InChI=1S/C15H24FNOS.C2H6O.C2H6/c1-3-13(10-15(17)11-16)5-4-12(2)14-6-8-19(18)9-7-14;1-3-2;1-2/h3-6,12,15H,7-11,17H2,1-2H3;1-2H3;1-2H3/b5-4-,13-3+;; |
| InChIKey | XSEJVPCHBZYIBR-MQOSEQLPSA-N |
| XLogP | 4.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|