C13H19NO — CID 105458052
3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 105458052) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 105458052 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(C)NCC1CCc2ccc(O)cc21 |
| InChI | InChI=1S/C13H19NO/c1-9(2)14-8-11-4-3-10-5-6-12(15)7-13(10)11/h5-7,9,11,14-15H,3-4,8H2,1-2H3 |
| InChIKey | XOMKLJPSDALRBX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |