About 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol
3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 105458052) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 105458052 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(C)NCC1CCc2ccc(O)cc21 |
| InChI | InChI=1S/C13H19NO/c1-9(2)14-8-11-4-3-10-5-6-12(15)7-13(10)11/h5-7,9,11,14-15H,3-4,8H2,1-2H3 |
| InChIKey | XOMKLJPSDALRBX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol (CID 105458052) is 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol is CC(C)NCC1CCc2ccc(O)cc21.
What is the InChIKey of 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol?
The InChIKey is XOMKLJPSDALRBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-9(2)14-8-11-4-3-10-5-6-12(15)7-13(10)11/h5-7,9,11,14-15H,3-4,8H2,1-2H3.
What are the key properties of 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol?
3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol has a molecular weight of 205.30 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(propan-2-ylamino)methyl]-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 105458052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).