C22H42OSi — CID 10545841
[2-ethenyl-6-methyl-2-(4-methylpent-4-enyl)hept-6-enoxy]-triethylsilane (PubChem CID 10545841) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is [2-ethenyl-6-methyl-2-(4-methylpent-4-enyl)hept-6-enoxy]-triethylsilane.
| Compound Name | [2-ethenyl-6-methyl-2-(4-methylpent-4-enyl)hept-6-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 10545841 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | [2-ethenyl-6-methyl-2-(4-methylpent-4-enyl)hept-6-enoxy]-triethylsilane |
| SMILES | C=CC(CCCC(=C)C)(CCCC(=C)C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H42OSi/c1-9-22(17-13-15-20(5)6,18-14-16-21(7)8)19-23-24(10-2,11-3)12-4/h9H,1,5,7,10-19H2,2-4,6,8H3 |
| InChIKey | IVZKVAXQOSGXCC-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|