C20H40OSi — CID 138966359
tert-butyl-[4-[(3Z)-1,3-dimethylcyclooct-3-en-1-yl]butoxy]-dimethylsilane (PubChem CID 138966359) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is tert-butyl-[4-[(3Z)-1,3-dimethylcyclooct-3-en-1-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[(3Z)-1,3-dimethylcyclooct-3-en-1-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 138966359 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl-[4-[(3Z)-1,3-dimethylcyclooct-3-en-1-yl]butoxy]-dimethylsilane |
| SMILES | C/C1=C/CCCCC(C)(CCCCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H40OSi/c1-18-13-9-8-10-14-20(5,17-18)15-11-12-16-21-22(6,7)19(2,3)4/h13H,8-12,14-17H2,1-7H3/b18-13- |
| InChIKey | RRNPCOLIRCVUSS-AQTBWJFISA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|