1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid

C7H13NO4S — CID 105460316

IUPAC1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid
SMILESCN1CC(S(C)(=O)=O)CC1C(=O)O
InChIInChI=1S/C7H13NO4S/c1-8-4-5(13(2,11)12)3-6(8)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)
InChIKeyUCAZTLHAEDSBHP-UHFFFAOYSA-N
MW207.25 g/mol
LogP-0.81
Rot. Bonds2

About 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid

1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid (PubChem CID 105460316) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid
PubChem CID105460316
Molecular FormulaC7H13NO4S
Molecular Weight207.25 g/mol
Exact Mass207.06
IUPAC Name1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid
SMILESCN1CC(S(C)(=O)=O)CC1C(=O)O
InChIInChI=1S/C7H13NO4S/c1-8-4-5(13(2,11)12)3-6(8)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)
InChIKeyUCAZTLHAEDSBHP-UHFFFAOYSA-N
XLogP-0.81
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 5-0.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid?
The IUPAC name of 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid (CID 105460316) is 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid is CN1CC(S(C)(=O)=O)CC1C(=O)O.
What is the InChIKey of 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid?
The InChIKey is UCAZTLHAEDSBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S/c1-8-4-5(13(2,11)12)3-6(8)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid?
1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid has a molecular weight of 207.25 g/mol, XLogP of -0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-methylsulfonylpyrrolidine-2-carboxylic acid is sourced from PubChem (CID 105460316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).