(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid

C7H13NO2 — CID 175489667

IUPAC(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid
SMILESCC1C[C@H](C(=O)O)N(C)C1
InChIInChI=1S/C7H13NO2/c1-5-3-6(7(9)10)8(2)4-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1
InChIKeyFAKNQOZVXKYTPZ-PRJDIBJQSA-N
MW143.19 g/mol
LogP0.41
Rot. Bonds1

About (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid

(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 175489667) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid
PubChem CID175489667
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid
SMILESCC1C[C@H](C(=O)O)N(C)C1
InChIInChI=1S/C7H13NO2/c1-5-3-6(7(9)10)8(2)4-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1
InChIKeyFAKNQOZVXKYTPZ-PRJDIBJQSA-N
XLogP0.41
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid (CID 175489667) is (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid is CC1C[C@H](C(=O)O)N(C)C1.
What is the InChIKey of (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid?
The InChIKey is FAKNQOZVXKYTPZ-PRJDIBJQSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-3-6(7(9)10)8(2)4-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1.
What are the key properties of (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid?
(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid has a molecular weight of 143.19 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid is sourced from PubChem (CID 175489667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).