C7H13NO2 — CID 175489667
(2R)-1,4-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 175489667) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175489667 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2R)-1,4-dimethylpyrrolidine-2-carboxylic acid |
| SMILES | CC1C[C@H](C(=O)O)N(C)C1 |
| InChI | InChI=1S/C7H13NO2/c1-5-3-6(7(9)10)8(2)4-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1 |
| InChIKey | FAKNQOZVXKYTPZ-PRJDIBJQSA-N |
| XLogP | 0.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |