C9H17NO — CID 89043897
1-[(2S,4R)-1,4-dimethylpyrrolidin-2-yl]propan-1-one (PubChem CID 89043897) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-[(2S,4R)-1,4-dimethylpyrrolidin-2-yl]propan-1-one.
| Compound Name | 1-[(2S,4R)-1,4-dimethylpyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 89043897 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-[(2S,4R)-1,4-dimethylpyrrolidin-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@@H]1C[C@@H](C)CN1C |
| InChI | InChI=1S/C9H17NO/c1-4-9(11)8-5-7(2)6-10(8)3/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | SLDASGMSJGSDGO-SFYZADRCSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |