C13H25NO — CID 106801147
6-(3,5-dimethylpiperidin-1-yl)hexan-3-one (PubChem CID 106801147) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 6-(3,5-dimethylpiperidin-1-yl)hexan-3-one.
| Compound Name | 6-(3,5-dimethylpiperidin-1-yl)hexan-3-one |
|---|---|
| PubChem CID | 106801147 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 6-(3,5-dimethylpiperidin-1-yl)hexan-3-one |
| SMILES | CCC(=O)CCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C13H25NO/c1-4-13(15)6-5-7-14-9-11(2)8-12(3)10-14/h11-12H,4-10H2,1-3H3 |
| InChIKey | YTIIJVABIREGML-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |