C10H20ClNO2S — CID 112594595
3-(3,5-dimethylpiperidin-1-yl)propane-1-sulfonyl chloride (PubChem CID 112594595) has the molecular formula C10H20ClNO2S and a molecular weight of 253.79 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)propane-1-sulfonyl chloride.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)propane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 112594595 |
| Molecular Formula | C10H20ClNO2S |
| Molecular Weight | 253.79 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)propane-1-sulfonyl chloride |
| SMILES | CC1CC(C)CN(CCCS(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C10H20ClNO2S/c1-9-6-10(2)8-12(7-9)4-3-5-15(11,13)14/h9-10H,3-8H2,1-2H3 |
| InChIKey | VPLJQIGZLMLPJF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |