3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride

C9H18ClNO2S — CID 102548987

IUPAC3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride
SMILESCC1CCCN(CCCS(=O)(=O)Cl)C1
InChIInChI=1S/C9H18ClNO2S/c1-9-4-2-5-11(8-9)6-3-7-14(10,12)13/h9H,2-8H2,1H3
InChIKeyMRPHQVWLPVXLHK-UHFFFAOYSA-N
MW239.77 g/mol
LogP1.68
Rot. Bonds4

About 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride

3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride (PubChem CID 102548987) has the molecular formula C9H18ClNO2S and a molecular weight of 239.77 g/mol. Its IUPAC name is 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride
PubChem CID102548987
Molecular FormulaC9H18ClNO2S
Molecular Weight239.77 g/mol
Exact Mass239.07
IUPAC Name3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride
SMILESCC1CCCN(CCCS(=O)(=O)Cl)C1
InChIInChI=1S/C9H18ClNO2S/c1-9-4-2-5-11(8-9)6-3-7-14(10,12)13/h9H,2-8H2,1H3
InChIKeyMRPHQVWLPVXLHK-UHFFFAOYSA-N
XLogP1.68
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.77
LogP ≤ 51.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride?
The IUPAC name of 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride (CID 102548987) is 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride.
What is the SMILES notation for 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride?
The canonical SMILES for 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride is CC1CCCN(CCCS(=O)(=O)Cl)C1.
What is the InChIKey of 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride?
The InChIKey is MRPHQVWLPVXLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClNO2S/c1-9-4-2-5-11(8-9)6-3-7-14(10,12)13/h9H,2-8H2,1H3.
What are the key properties of 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride?
3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride has a molecular weight of 239.77 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylpiperidin-1-yl)propane-1-sulfonyl chloride is sourced from PubChem (CID 102548987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).