C16H32BrN — CID 105343565
1-(9-bromononyl)-3,5-dimethylpiperidine (PubChem CID 105343565) has the molecular formula C16H32BrN and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-(9-bromononyl)-3,5-dimethylpiperidine.
| Compound Name | 1-(9-bromononyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 105343565 |
| Molecular Formula | C16H32BrN |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(9-bromononyl)-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(CCCCCCCCCBr)C1 |
| InChI | InChI=1S/C16H32BrN/c1-15-12-16(2)14-18(13-15)11-9-7-5-3-4-6-8-10-17/h15-16H,3-14H2,1-2H3 |
| InChIKey | OKXAKHBULXUFBZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|