C12H17NO2 — CID 105460356
2-(3-hydroxyphenyl)-1-methylpiperidin-3-ol (PubChem CID 105460356) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-1-methylpiperidin-3-ol.
| Compound Name | 2-(3-hydroxyphenyl)-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 105460356 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(3-hydroxyphenyl)-1-methylpiperidin-3-ol |
| SMILES | CN1CCCC(O)C1c1cccc(O)c1 |
| InChI | InChI=1S/C12H17NO2/c1-13-7-3-6-11(15)12(13)9-4-2-5-10(14)8-9/h2,4-5,8,11-12,14-15H,3,6-7H2,1H3 |
| InChIKey | HAJYJHUHCWZHIJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |