C19H20FNO — CID 22767533
5-(3-fluorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-8-ol (PubChem CID 22767533) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-8-ol.
| Compound Name | 5-(3-fluorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-8-ol |
|---|---|
| PubChem CID | 22767533 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-(3-fluorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-8-ol |
| SMILES | CN1CCCC2C(c3cccc(F)c3)c3ccc(O)cc3C21 |
| InChI | InChI=1S/C19H20FNO/c1-21-9-3-6-16-18(12-4-2-5-13(20)10-12)15-8-7-14(22)11-17(15)19(16)21/h2,4-5,7-8,10-11,16,18-19,22H,3,6,9H2,1H3 |
| InChIKey | TZJNZNYZBLUENR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |