C20H23N — CID 24839459
(4aR,5R,9bR)-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 24839459) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (4aR,5R,9bR)-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | (4aR,5R,9bR)-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 24839459 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (4aR,5R,9bR)-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | Cc1ccccc1[C@@H]1c2ccccc2[C@H]2[C@@H]1CCCN2C |
| InChI | InChI=1S/C20H23N/c1-14-8-3-4-9-15(14)19-16-10-5-6-11-17(16)20-18(19)12-7-13-21(20)2/h3-6,8-11,18-20H,7,12-13H2,1-2H3/t18-,19-,20+/m1/s1 |
| InChIKey | XBVLZQCASBEHIB-AQNXPRMDSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |