C20H22FNO — CID 22767435
5-(3-fluorophenyl)-7-methoxy-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 22767435) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-7-methoxy-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | 5-(3-fluorophenyl)-7-methoxy-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 22767435 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-(3-fluorophenyl)-7-methoxy-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | COc1ccc2c(c1)C(c1cccc(F)c1)C1CCCN(C)C21 |
| InChI | InChI=1S/C20H22FNO/c1-22-10-4-7-17-19(13-5-3-6-14(21)11-13)18-12-15(23-2)8-9-16(18)20(17)22/h3,5-6,8-9,11-12,17,19-20H,4,7,10H2,1-2H3 |
| InChIKey | MBYBMNPVIYVCCA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |