C20H23NO — CID 22767440
8-methoxy-5-(3-methylphenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine (PubChem CID 22767440) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 8-methoxy-5-(3-methylphenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine.
| Compound Name | 8-methoxy-5-(3-methylphenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 22767440 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 8-methoxy-5-(3-methylphenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
| SMILES | COc1ccc2c(c1)C1NCCCC1C2c1cccc(C)c1 |
| InChI | InChI=1S/C20H23NO/c1-13-5-3-6-14(11-13)19-16-9-8-15(22-2)12-18(16)20-17(19)7-4-10-21-20/h3,5-6,8-9,11-12,17,19-21H,4,7,10H2,1-2H3 |
| InChIKey | VHZKZDLIYHENAO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |