C18H20N2 — CID 22767493
3-(2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-5-yl)aniline (PubChem CID 22767493) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-5-yl)aniline.
| Compound Name | 3-(2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-5-yl)aniline |
|---|---|
| PubChem CID | 22767493 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3-(2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-5-yl)aniline |
| SMILES | Nc1cccc(C2c3ccccc3C3NCCCC32)c1 |
| InChI | InChI=1S/C18H20N2/c19-13-6-3-5-12(11-13)17-14-7-1-2-8-15(14)18-16(17)9-4-10-20-18/h1-3,5-8,11,16-18,20H,4,9-10,19H2 |
| InChIKey | WGOPNFQXUSGBOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|