C18H18FNO — CID 22767497
5-(2-fluorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol (PubChem CID 22767497) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol.
| Compound Name | 5-(2-fluorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol |
|---|---|
| PubChem CID | 22767497 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-(2-fluorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol |
| SMILES | Oc1ccc2c(c1)C1NCCCC1C2c1ccccc1F |
| InChI | InChI=1S/C18H18FNO/c19-16-6-2-1-4-13(16)17-12-8-7-11(21)10-15(12)18-14(17)5-3-9-20-18/h1-2,4,6-8,10,14,17-18,20-21H,3,5,9H2 |
| InChIKey | IQNWFERGQFBTEG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |