C13H17NO2 — CID 177207224
8-methoxy-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[4,3-b]pyridine (PubChem CID 177207224) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 8-methoxy-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[4,3-b]pyridine.
| Compound Name | 8-methoxy-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[4,3-b]pyridine |
|---|---|
| PubChem CID | 177207224 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 8-methoxy-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[4,3-b]pyridine |
| SMILES | COc1ccc2c(c1)COC1CCCNC21 |
| InChI | InChI=1S/C13H17NO2/c1-15-10-4-5-11-9(7-10)8-16-12-3-2-6-14-13(11)12/h4-5,7,12-14H,2-3,6,8H2,1H3 |
| InChIKey | OBDGIKIVJPGGGH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |