C17H18INO — CID 131988987
1-(4-iodophenyl)-7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 131988987) has the molecular formula C17H18INO and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-(4-iodophenyl)-7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine.
| Compound Name | 1-(4-iodophenyl)-7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 131988987 |
| Molecular Formula | C17H18INO |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 1-(4-iodophenyl)-7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine |
| SMILES | COc1ccc2c(c1)CCCNC2c1ccc(I)cc1 |
| InChI | InChI=1S/C17H18INO/c1-20-15-8-9-16-13(11-15)3-2-10-19-17(16)12-4-6-14(18)7-5-12/h4-9,11,17,19H,2-3,10H2,1H3 |
| InChIKey | RFTDVCMRIZYIQU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|