C12H15NO2 — CID 175293128
7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine-1-carbaldehyde (PubChem CID 175293128) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine-1-carbaldehyde.
| Compound Name | 7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine-1-carbaldehyde |
|---|---|
| PubChem CID | 175293128 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 7-methoxy-2,3,4,5-tetrahydro-1H-2-benzazepine-1-carbaldehyde |
| SMILES | COc1ccc2c(c1)CCCNC2C=O |
| InChI | InChI=1S/C12H15NO2/c1-15-10-4-5-11-9(7-10)3-2-6-13-12(11)8-14/h4-5,7-8,12-13H,2-3,6H2,1H3 |
| InChIKey | OFJOAALACBYAQC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|