C11H15NO3S — CID 115000583
6-methoxy-1,2,3,4-tetrahydronaphthalene-1-sulfonamide (PubChem CID 115000583) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydronaphthalene-1-sulfonamide.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydronaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 115000583 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydronaphthalene-1-sulfonamide |
| SMILES | COc1ccc2c(c1)CCCC2S(N)(=O)=O |
| InChI | InChI=1S/C11H15NO3S/c1-15-9-5-6-10-8(7-9)3-2-4-11(10)16(12,13)14/h5-7,11H,2-4H2,1H3,(H2,12,13,14) |
| InChIKey | CVSGQDDZKVXYJI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |