C17H20N2O3S — CID 124639032
N'-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]benzenesulfonohydrazide (PubChem CID 124639032) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N'-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]benzenesulfonohydrazide.
| Compound Name | N'-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 124639032 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N'-[(1S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]benzenesulfonohydrazide |
| SMILES | COc1ccc2c(c1)CCC[C@@H]2NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-22-14-10-11-16-13(12-14)6-5-9-17(16)18-19-23(20,21)15-7-3-2-4-8-15/h2-4,7-8,10-12,17-19H,5-6,9H2,1H3/t17-/m0/s1 |
| InChIKey | PVDPYRAVAUXIMC-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|