C13H16Cl3NO4S — CID 24761683
2,2,2-trichloroethyl N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate (PubChem CID 24761683) has the molecular formula C13H16Cl3NO4S and a molecular weight of 388.70 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate |
|---|---|
| PubChem CID | 24761683 |
| Molecular Formula | C13H16Cl3NO4S |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 2,2,2-trichloroethyl N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamate |
| SMILES | COc1ccc2c(c1)CCCC2NS(=O)(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3NO4S/c1-20-10-5-6-11-9(7-10)3-2-4-12(11)17-22(18,19)21-8-13(14,15)16/h5-7,12,17H,2-4,8H2,1H3 |
| InChIKey | HZWFFHACBYVHEH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|