C12H17NO2 — CID 105460510
4-(ethylaminomethyl)-3,4-dihydro-2H-chromen-8-ol (PubChem CID 105460510) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-3,4-dihydro-2H-chromen-8-ol.
| Compound Name | 4-(ethylaminomethyl)-3,4-dihydro-2H-chromen-8-ol |
|---|---|
| PubChem CID | 105460510 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-(ethylaminomethyl)-3,4-dihydro-2H-chromen-8-ol |
| SMILES | CCNCC1CCOc2c(O)cccc21 |
| InChI | InChI=1S/C12H17NO2/c1-2-13-8-9-6-7-15-12-10(9)4-3-5-11(12)14/h3-5,9,13-14H,2,6-8H2,1H3 |
| InChIKey | YXSBOGREIZUIJK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |