C10H9NO3 — CID 112709579
4-isocyanato-3,4-dihydro-2H-chromen-8-ol (PubChem CID 112709579) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-isocyanato-3,4-dihydro-2H-chromen-8-ol.
| Compound Name | 4-isocyanato-3,4-dihydro-2H-chromen-8-ol |
|---|---|
| PubChem CID | 112709579 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-isocyanato-3,4-dihydro-2H-chromen-8-ol |
| SMILES | O=C=NC1CCOc2c(O)cccc21 |
| InChI | InChI=1S/C10H9NO3/c12-6-11-8-4-5-14-10-7(8)2-1-3-9(10)13/h1-3,8,13H,4-5H2 |
| InChIKey | WDYWCJFUPFQTAJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|