C10H9NO2 — CID 95014453
(4S)-4-isocyanato-3,4-dihydro-2H-chromene (PubChem CID 95014453) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is (4S)-4-isocyanato-3,4-dihydro-2H-chromene.
| Compound Name | (4S)-4-isocyanato-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 95014453 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (4S)-4-isocyanato-3,4-dihydro-2H-chromene |
| SMILES | O=C=N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C10H9NO2/c12-7-11-9-5-6-13-10-4-2-1-3-8(9)10/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | AXOVCCFEDUFHIU-VIFPVBQESA-N |
| XLogP | 1.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|