C10H13N3O — CID 94480482
2-[(4S)-3,4-dihydro-2H-chromen-4-yl]guanidine (PubChem CID 94480482) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[(4S)-3,4-dihydro-2H-chromen-4-yl]guanidine.
| Compound Name | 2-[(4S)-3,4-dihydro-2H-chromen-4-yl]guanidine |
|---|---|
| PubChem CID | 94480482 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[(4S)-3,4-dihydro-2H-chromen-4-yl]guanidine |
| SMILES | NC(N)=N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C10H13N3O/c11-10(12)13-8-5-6-14-9-4-2-1-3-7(8)9/h1-4,8H,5-6H2,(H4,11,12,13)/t8-/m0/s1 |
| InChIKey | OEWUASFVGSTNQU-QMMMGPOBSA-N |
| XLogP | 0.78 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|