C11H9NO2S — CID 63708672
3,4-dihydro-2H-chromene-4-carbonyl isothiocyanate (PubChem CID 63708672) has the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-4-carbonyl isothiocyanate.
| Compound Name | 3,4-dihydro-2H-chromene-4-carbonyl isothiocyanate |
|---|---|
| PubChem CID | 63708672 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 3,4-dihydro-2H-chromene-4-carbonyl isothiocyanate |
| SMILES | O=C(N=C=S)C1CCOc2ccccc21 |
| InChI | InChI=1S/C11H9NO2S/c13-11(12-7-15)9-5-6-14-10-4-2-1-3-8(9)10/h1-4,9H,5-6H2 |
| InChIKey | NCHCUNRYXJXDMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|