2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid

C12H13FO2 — CID 105461592

IUPAC2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid
SMILESCc1cccc2c1CC(F)(C(=O)O)CC2
InChIInChI=1S/C12H13FO2/c1-8-3-2-4-9-5-6-12(13,11(14)15)7-10(8)9/h2-4H,5-7H2,1H3,(H,14,15)
InChIKeySFZPKFJJPGDNKA-UHFFFAOYSA-N
MW208.23 g/mol
LogP2.28
Rot. Bonds1

About 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid

2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 105461592) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid
PubChem CID105461592
Molecular FormulaC12H13FO2
Molecular Weight208.23 g/mol
Exact Mass208.09
IUPAC Name2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid
SMILESCc1cccc2c1CC(F)(C(=O)O)CC2
InChIInChI=1S/C12H13FO2/c1-8-3-2-4-9-5-6-12(13,11(14)15)7-10(8)9/h2-4H,5-7H2,1H3,(H,14,15)
InChIKeySFZPKFJJPGDNKA-UHFFFAOYSA-N
XLogP2.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.23
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The IUPAC name of 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid (CID 105461592) is 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
What is the SMILES notation for 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The canonical SMILES for 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid is Cc1cccc2c1CC(F)(C(=O)O)CC2.
What is the InChIKey of 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The InChIKey is SFZPKFJJPGDNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2/c1-8-3-2-4-9-5-6-12(13,11(14)15)7-10(8)9/h2-4H,5-7H2,1H3,(H,14,15).
What are the key properties of 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid has a molecular weight of 208.23 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-8-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid is sourced from PubChem (CID 105461592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).