C12H20N2O — CID 105462116
4-[(1-amino-3,3-dimethylbutan-2-yl)amino]phenol (PubChem CID 105462116) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-[(1-amino-3,3-dimethylbutan-2-yl)amino]phenol.
| Compound Name | 4-[(1-amino-3,3-dimethylbutan-2-yl)amino]phenol |
|---|---|
| PubChem CID | 105462116 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-[(1-amino-3,3-dimethylbutan-2-yl)amino]phenol |
| SMILES | CC(C)(C)C(CN)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C12H20N2O/c1-12(2,3)11(8-13)14-9-4-6-10(15)7-5-9/h4-7,11,14-15H,8,13H2,1-3H3 |
| InChIKey | HHSRGLPXUVEGAG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|