C10H13F3N2O — CID 84726902
4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]amino]phenol (PubChem CID 84726902) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]amino]phenol.
| Compound Name | 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]amino]phenol |
|---|---|
| PubChem CID | 84726902 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]amino]phenol |
| SMILES | NCC(CNc1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)7(5-14)6-15-8-1-3-9(16)4-2-8/h1-4,7,15-16H,5-6,14H2 |
| InChIKey | QFOBJNRBTZLYJB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|