C10H12ClF3N2 — CID 84729053
N'-(4-chlorophenyl)-2-(trifluoromethyl)propane-1,3-diamine (PubChem CID 84729053) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-2-(trifluoromethyl)propane-1,3-diamine.
| Compound Name | N'-(4-chlorophenyl)-2-(trifluoromethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 84729053 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N'-(4-chlorophenyl)-2-(trifluoromethyl)propane-1,3-diamine |
| SMILES | NCC(CNc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2/c11-8-1-3-9(4-2-8)16-6-7(5-15)10(12,13)14/h1-4,7,16H,5-6,15H2 |
| InChIKey | GDAUOHGMNNQZOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |