C10H12F3NO — CID 115031161
4-[2-(aminomethyl)-3,3,3-trifluoropropyl]phenol (PubChem CID 115031161) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-3,3,3-trifluoropropyl]phenol.
| Compound Name | 4-[2-(aminomethyl)-3,3,3-trifluoropropyl]phenol |
|---|---|
| PubChem CID | 115031161 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-[2-(aminomethyl)-3,3,3-trifluoropropyl]phenol |
| SMILES | NCC(Cc1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO/c11-10(12,13)8(6-14)5-7-1-3-9(15)4-2-7/h1-4,8,15H,5-6,14H2 |
| InChIKey | YULVFFMLHHTTAC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |