C13H21NO — CID 96616484
4-[(2R)-2-amino-4,4-dimethylpentyl]phenol (PubChem CID 96616484) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-[(2R)-2-amino-4,4-dimethylpentyl]phenol.
| Compound Name | 4-[(2R)-2-amino-4,4-dimethylpentyl]phenol |
|---|---|
| PubChem CID | 96616484 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-[(2R)-2-amino-4,4-dimethylpentyl]phenol |
| SMILES | CC(C)(C)C[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H21NO/c1-13(2,3)9-11(14)8-10-4-6-12(15)7-5-10/h4-7,11,15H,8-9,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | YXUHIRXIVADZFB-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |