About 2-fluoro-N'-phenylpropane-1,3-diamine
2-fluoro-N'-phenylpropane-1,3-diamine (PubChem CID 105433807) has the molecular formula C9H13FN2
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-fluoro-N'-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-fluoro-N'-phenylpropane-1,3-diamine |
| PubChem CID | 105433807 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-fluoro-N'-phenylpropane-1,3-diamine |
| SMILES | NCC(F)CNc1ccccc1 |
| InChI | InChI=1S/C9H13FN2/c10-8(6-11)7-12-9-4-2-1-3-5-9/h1-5,8,12H,6-7,11H2 |
| InChIKey | WPISVJAYEWTVEH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-N'-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-phenylpropane-1,3-diamine?
The IUPAC name of 2-fluoro-N'-phenylpropane-1,3-diamine (CID 105433807) is 2-fluoro-N'-phenylpropane-1,3-diamine.
What is the SMILES notation for 2-fluoro-N'-phenylpropane-1,3-diamine?
The canonical SMILES for 2-fluoro-N'-phenylpropane-1,3-diamine is NCC(F)CNc1ccccc1.
What is the InChIKey of 2-fluoro-N'-phenylpropane-1,3-diamine?
The InChIKey is WPISVJAYEWTVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c10-8(6-11)7-12-9-4-2-1-3-5-9/h1-5,8,12H,6-7,11H2.
What are the key properties of 2-fluoro-N'-phenylpropane-1,3-diamine?
2-fluoro-N'-phenylpropane-1,3-diamine has a molecular weight of 168.22 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-phenylpropane-1,3-diamine is sourced from PubChem (CID 105433807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).