C9H13FN2 — CID 105433807
2-fluoro-N'-phenylpropane-1,3-diamine (PubChem CID 105433807) has the molecular formula C9H13FN2 and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-fluoro-N'-phenylpropane-1,3-diamine.
| Compound Name | 2-fluoro-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 105433807 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-fluoro-N'-phenylpropane-1,3-diamine |
| SMILES | NCC(F)CNc1ccccc1 |
| InChI | InChI=1S/C9H13FN2/c10-8(6-11)7-12-9-4-2-1-3-5-9/h1-5,8,12H,6-7,11H2 |
| InChIKey | WPISVJAYEWTVEH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |