About 1-amino-2-anilinoethanol
1-amino-2-anilinoethanol (PubChem CID 54286676) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-amino-2-anilinoethanol.
Molecular Properties
| Compound Name | 1-amino-2-anilinoethanol |
| PubChem CID | 54286676 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-amino-2-anilinoethanol |
| SMILES | NC(O)CNc1ccccc1 |
| InChI | InChI=1S/C8H12N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-5,8,10-11H,6,9H2 |
| InChIKey | GYVMBFVEKRTZLS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-anilinoethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-anilinoethanol?
The IUPAC name of 1-amino-2-anilinoethanol (CID 54286676) is 1-amino-2-anilinoethanol.
What is the SMILES notation for 1-amino-2-anilinoethanol?
The canonical SMILES for 1-amino-2-anilinoethanol is NC(O)CNc1ccccc1.
What is the InChIKey of 1-amino-2-anilinoethanol?
The InChIKey is GYVMBFVEKRTZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-5,8,10-11H,6,9H2.
What are the key properties of 1-amino-2-anilinoethanol?
1-amino-2-anilinoethanol has a molecular weight of 152.20 g/mol, XLogP of 0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-anilinoethanol is sourced from PubChem (CID 54286676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).