C8H15FO3S — CID 105464114
1-(1,1-dioxothian-3-yl)-1-fluoropropan-2-ol (PubChem CID 105464114) has the molecular formula C8H15FO3S and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-1-fluoropropan-2-ol.
| Compound Name | 1-(1,1-dioxothian-3-yl)-1-fluoropropan-2-ol |
|---|---|
| PubChem CID | 105464114 |
| Molecular Formula | C8H15FO3S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-1-fluoropropan-2-ol |
| SMILES | CC(O)C(F)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15FO3S/c1-6(10)8(9)7-3-2-4-13(11,12)5-7/h6-8,10H,2-5H2,1H3 |
| InChIKey | HQLVYWJACJCWHF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |