C11H18N2S — CID 105464499
4-propan-2-yl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole (PubChem CID 105464499) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 4-propan-2-yl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole.
| Compound Name | 4-propan-2-yl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 105464499 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-propan-2-yl-2-(pyrrolidin-3-ylmethyl)-1,3-thiazole |
| SMILES | CC(C)c1csc(CC2CCNC2)n1 |
| InChI | InChI=1S/C11H18N2S/c1-8(2)10-7-14-11(13-10)5-9-3-4-12-6-9/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | ZZVYINGFMFQVTP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |