C11H18N2OS — CID 115088902
1-[2-(piperidin-3-ylmethyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 115088902) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-[2-(piperidin-3-ylmethyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(piperidin-3-ylmethyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 115088902 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-[2-(piperidin-3-ylmethyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(CC2CCCNC2)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-8(14)10-7-15-11(13-10)5-9-3-2-4-12-6-9/h7-9,12,14H,2-6H2,1H3 |
| InChIKey | GCJSZNRQPOZZKE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |