About 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine
1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine (PubChem CID 105464935) has the molecular formula C12H15F2N
and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine |
| PubChem CID | 105464935 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine |
| SMILES | Cc1ccccc1C(F)(F)CC1(N)CC1 |
| InChI | InChI=1S/C12H15F2N/c1-9-4-2-3-5-10(9)12(13,14)8-11(15)6-7-11/h2-5H,6-8,15H2,1H3 |
| InChIKey | ZJLDCQVPOHCGNL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine?
The IUPAC name of 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine (CID 105464935) is 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine?
The canonical SMILES for 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine is Cc1ccccc1C(F)(F)CC1(N)CC1.
What is the InChIKey of 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine?
The InChIKey is ZJLDCQVPOHCGNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c1-9-4-2-3-5-10(9)12(13,14)8-11(15)6-7-11/h2-5H,6-8,15H2,1H3.
What are the key properties of 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine?
1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine has a molecular weight of 211.26 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-difluoro-2-(2-methylphenyl)ethyl]cyclopropan-1-amine is sourced from PubChem (CID 105464935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).