About methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate
methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 105466730) has the molecular formula C8H11N3O2S
and a molecular weight of 213.26 g/mol. Its IUPAC name is methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate.
Analyze methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate?
The IUPAC name of methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate (CID 105466730) is methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate?
The canonical SMILES for methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate is COC(=O)c1nnc(C2CCNC2)s1.
What is the InChIKey of methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate?
The InChIKey is ZOJJUZZBJARFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2S/c1-13-8(12)7-11-10-6(14-7)5-2-3-9-4-5/h5,9H,2-4H2,1H3.
What are the key properties of methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate?
methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate has a molecular weight of 213.26 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-pyrrolidin-3-yl-1,3,4-thiadiazole-2-carboxylate is sourced from PubChem (CID 105466730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).