C12H17F2N — CID 105466737
3-fluoro-3-(2-fluorophenyl)-2,2-dimethylbutan-1-amine (PubChem CID 105466737) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-fluoro-3-(2-fluorophenyl)-2,2-dimethylbutan-1-amine.
| Compound Name | 3-fluoro-3-(2-fluorophenyl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105466737 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-fluoro-3-(2-fluorophenyl)-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CN)C(C)(F)c1ccccc1F |
| InChI | InChI=1S/C12H17F2N/c1-11(2,8-15)12(3,14)9-6-4-5-7-10(9)13/h4-7H,8,15H2,1-3H3 |
| InChIKey | UUJGORLGDYTLEY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |