C12H17F2N — CID 105425410
2-(2-tert-butylphenyl)-2,2-difluoroethanamine (PubChem CID 105425410) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-(2-tert-butylphenyl)-2,2-difluoroethanamine.
| Compound Name | 2-(2-tert-butylphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 105425410 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(2-tert-butylphenyl)-2,2-difluoroethanamine |
| SMILES | CC(C)(C)c1ccccc1C(F)(F)CN |
| InChI | InChI=1S/C12H17F2N/c1-11(2,3)9-6-4-5-7-10(9)12(13,14)8-15/h4-7H,8,15H2,1-3H3 |
| InChIKey | ZJEZKYBBVKPKEC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |