About 2-(2-tert-butylphenyl)-2,2-difluoroethanamine
2-(2-tert-butylphenyl)-2,2-difluoroethanamine (PubChem CID 105425410) has the molecular formula C12H17F2N
and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-(2-tert-butylphenyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 2-(2-tert-butylphenyl)-2,2-difluoroethanamine |
| PubChem CID | 105425410 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(2-tert-butylphenyl)-2,2-difluoroethanamine |
| SMILES | CC(C)(C)c1ccccc1C(F)(F)CN |
| InChI | InChI=1S/C12H17F2N/c1-11(2,3)9-6-4-5-7-10(9)12(13,14)8-15/h4-7H,8,15H2,1-3H3 |
| InChIKey | ZJEZKYBBVKPKEC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-tert-butylphenyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-tert-butylphenyl)-2,2-difluoroethanamine?
The IUPAC name of 2-(2-tert-butylphenyl)-2,2-difluoroethanamine (CID 105425410) is 2-(2-tert-butylphenyl)-2,2-difluoroethanamine.
What is the SMILES notation for 2-(2-tert-butylphenyl)-2,2-difluoroethanamine?
The canonical SMILES for 2-(2-tert-butylphenyl)-2,2-difluoroethanamine is CC(C)(C)c1ccccc1C(F)(F)CN.
What is the InChIKey of 2-(2-tert-butylphenyl)-2,2-difluoroethanamine?
The InChIKey is ZJEZKYBBVKPKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N/c1-11(2,3)9-6-4-5-7-10(9)12(13,14)8-15/h4-7H,8,15H2,1-3H3.
What are the key properties of 2-(2-tert-butylphenyl)-2,2-difluoroethanamine?
2-(2-tert-butylphenyl)-2,2-difluoroethanamine has a molecular weight of 213.27 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butylphenyl)-2,2-difluoroethanamine is sourced from PubChem (CID 105425410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).