C13H15N3 — CID 105466959
3-[(2-methylanilino)methyl]pyridin-4-amine (PubChem CID 105466959) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-[(2-methylanilino)methyl]pyridin-4-amine.
| Compound Name | 3-[(2-methylanilino)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 105466959 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-[(2-methylanilino)methyl]pyridin-4-amine |
| SMILES | Cc1ccccc1NCc1cnccc1N |
| InChI | InChI=1S/C13H15N3/c1-10-4-2-3-5-13(10)16-9-11-8-15-7-6-12(11)14/h2-8,16H,9H2,1H3,(H2,14,15) |
| InChIKey | COLUWTUYPXWDTK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |