C13H15N3 — CID 105467013
1-[2-(1,7-naphthyridin-3-yl)ethyl]cyclopropan-1-amine (PubChem CID 105467013) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-[2-(1,7-naphthyridin-3-yl)ethyl]cyclopropan-1-amine.
| Compound Name | 1-[2-(1,7-naphthyridin-3-yl)ethyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 105467013 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-[2-(1,7-naphthyridin-3-yl)ethyl]cyclopropan-1-amine |
| SMILES | NC1(CCc2cnc3cnccc3c2)CC1 |
| InChI | InChI=1S/C13H15N3/c14-13(4-5-13)3-1-10-7-11-2-6-15-9-12(11)16-8-10/h2,6-9H,1,3-5,14H2 |
| InChIKey | KEQRKQIJJCHHIX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |