C11H11N3 — CID 84769745
1-(1,7-naphthyridin-3-yl)cyclopropan-1-amine (PubChem CID 84769745) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-(1,7-naphthyridin-3-yl)cyclopropan-1-amine.
| Compound Name | 1-(1,7-naphthyridin-3-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84769745 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-(1,7-naphthyridin-3-yl)cyclopropan-1-amine |
| SMILES | NC1(c2cnc3cnccc3c2)CC1 |
| InChI | InChI=1S/C11H11N3/c12-11(2-3-11)9-5-8-1-4-13-7-10(8)14-6-9/h1,4-7H,2-3,12H2 |
| InChIKey | ACNQNYUQRRYWGO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |