C22H24N2O3 — CID 10546734
2-[(2E)-2-[2-(4-methylphenyl)-2-oxoethylidene]imidazolidin-1-yl]ethyl 4-methylbenzoate (PubChem CID 10546734) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[(2E)-2-[2-(4-methylphenyl)-2-oxoethylidene]imidazolidin-1-yl]ethyl 4-methylbenzoate.
| Compound Name | 2-[(2E)-2-[2-(4-methylphenyl)-2-oxoethylidene]imidazolidin-1-yl]ethyl 4-methylbenzoate |
|---|---|
| PubChem CID | 10546734 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[(2E)-2-[2-(4-methylphenyl)-2-oxoethylidene]imidazolidin-1-yl]ethyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)/C=C2\NCCN2CCOC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-3-7-18(8-4-16)20(25)15-21-23-11-12-24(21)13-14-27-22(26)19-9-5-17(2)6-10-19/h3-10,15,23H,11-14H2,1-2H3/b21-15+ |
| InChIKey | MKLGLMDSWITZJF-RCCKNPSSSA-N |
| XLogP | 3.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|