C21H22N2O3 — CID 12026076
ethyl 2-(2-imidazolidin-2-ylidene-3-oxo-3-phenylpropyl)benzoate (PubChem CID 12026076) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 2-(2-imidazolidin-2-ylidene-3-oxo-3-phenylpropyl)benzoate.
| Compound Name | ethyl 2-(2-imidazolidin-2-ylidene-3-oxo-3-phenylpropyl)benzoate |
|---|---|
| PubChem CID | 12026076 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethyl 2-(2-imidazolidin-2-ylidene-3-oxo-3-phenylpropyl)benzoate |
| SMILES | CCOC(=O)c1ccccc1CC(C(=O)c1ccccc1)=C1NCCN1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-26-21(25)17-11-7-6-10-16(17)14-18(20-22-12-13-23-20)19(24)15-8-4-3-5-9-15/h3-11,22-23H,2,12-14H2,1H3 |
| InChIKey | OACADLUIHMPBDU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|