C17H22N2O3 — CID 14265727
ethyl 4-(2,4-dimethylphenyl)-3-imidazolidin-2-ylidene-4-oxobutanoate (PubChem CID 14265727) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl 4-(2,4-dimethylphenyl)-3-imidazolidin-2-ylidene-4-oxobutanoate.
| Compound Name | ethyl 4-(2,4-dimethylphenyl)-3-imidazolidin-2-ylidene-4-oxobutanoate |
|---|---|
| PubChem CID | 14265727 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethyl 4-(2,4-dimethylphenyl)-3-imidazolidin-2-ylidene-4-oxobutanoate |
| SMILES | CCOC(=O)CC(C(=O)c1ccc(C)cc1C)=C1NCCN1 |
| InChI | InChI=1S/C17H22N2O3/c1-4-22-15(20)10-14(17-18-7-8-19-17)16(21)13-6-5-11(2)9-12(13)3/h5-6,9,18-19H,4,7-8,10H2,1-3H3 |
| InChIKey | OAPSYFKLBQEEBX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|